C28H32N4O4 — CID 42742573
ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-phenyl-6-propan-2-ylpyrimidine-5-carboxylate (PubChem CID 42742573) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-phenyl-6-propan-2-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-phenyl-6-propan-2-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42742573 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | ethyl 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-phenyl-6-propan-2-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C(=O)N2CCN(c3ccc(OC)cc3)CC2)nc(-c2ccccc2)nc1C(C)C |
| InChI | InChI=1S/C28H32N4O4/c1-5-36-28(34)23-24(19(2)3)29-26(20-9-7-6-8-10-20)30-25(23)27(33)32-17-15-31(16-18-32)21-11-13-22(35-4)14-12-21/h6-14,19H,5,15-18H2,1-4H3 |
| InChIKey | PEYFGADICKSCCX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|