C23H25N5O6 — CID 5033555
prop-2-enyl 2,4-dimethyl-6-[3-methyl-4-(3-nitrobenzoyl)piperazine-1-carbonyl]pyrimidine-5-carboxylate (PubChem CID 5033555) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is prop-2-enyl 2,4-dimethyl-6-[3-methyl-4-(3-nitrobenzoyl)piperazine-1-carbonyl]pyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 2,4-dimethyl-6-[3-methyl-4-(3-nitrobenzoyl)piperazine-1-carbonyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5033555 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | prop-2-enyl 2,4-dimethyl-6-[3-methyl-4-(3-nitrobenzoyl)piperazine-1-carbonyl]pyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc(C)nc1C(=O)N1CCN(C(=O)c2cccc([N+](=O)[O-])c2)C(C)C1 |
| InChI | InChI=1S/C23H25N5O6/c1-5-11-34-23(31)19-15(3)24-16(4)25-20(19)22(30)26-9-10-27(14(2)13-26)21(29)17-7-6-8-18(12-17)28(32)33/h5-8,12,14H,1,9-11,13H2,2-4H3 |
| InChIKey | GAJDEDIOAOQDLE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 135.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|