C33H27N3O — CID 4274749
2-[2-(1-benzyl-2-methylindol-3-yl)ethenyl]-3-(3-methylphenyl)quinazolin-4-one (PubChem CID 4274749) has the molecular formula C33H27N3O and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[2-(1-benzyl-2-methylindol-3-yl)ethenyl]-3-(3-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(1-benzyl-2-methylindol-3-yl)ethenyl]-3-(3-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4274749 |
| Molecular Formula | C33H27N3O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[2-(1-benzyl-2-methylindol-3-yl)ethenyl]-3-(3-methylphenyl)quinazolin-4-one |
| SMILES | Cc1cccc(-n2c(C=Cc3c(C)n(Cc4ccccc4)c4ccccc34)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C33H27N3O/c1-23-11-10-14-26(21-23)36-32(34-30-17-8-6-16-29(30)33(36)37)20-19-27-24(2)35(22-25-12-4-3-5-13-25)31-18-9-7-15-28(27)31/h3-21H,22H2,1-2H3 |
| InChIKey | PJMLTWPPWJHGIT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |