C30H28N4O2 — CID 42748829
2-(4-benzhydrylpiperazine-1-carbonyl)-1-(4-methoxyphenyl)pyrrole-3-carbonitrile (PubChem CID 42748829) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazine-1-carbonyl)-1-(4-methoxyphenyl)pyrrole-3-carbonitrile.
| Compound Name | 2-(4-benzhydrylpiperazine-1-carbonyl)-1-(4-methoxyphenyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 42748829 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-(4-benzhydrylpiperazine-1-carbonyl)-1-(4-methoxyphenyl)pyrrole-3-carbonitrile |
| SMILES | COc1ccc(-n2ccc(C#N)c2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H28N4O2/c1-36-27-14-12-26(13-15-27)34-17-16-25(22-31)29(34)30(35)33-20-18-32(19-21-33)28(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-17,28H,18-21H2,1H3 |
| InChIKey | YAAMXHSZNABKMO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |