C26H25N3O4 — CID 42750681
ethyl 1-[3-cyano-1-(4-phenoxyphenyl)pyrrole-2-carbonyl]piperidine-4-carboxylate (PubChem CID 42750681) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 1-[3-cyano-1-(4-phenoxyphenyl)pyrrole-2-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-cyano-1-(4-phenoxyphenyl)pyrrole-2-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42750681 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | ethyl 1-[3-cyano-1-(4-phenoxyphenyl)pyrrole-2-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2c(C#N)ccn2-c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H25N3O4/c1-2-32-26(31)19-12-15-28(16-13-19)25(30)24-20(18-27)14-17-29(24)21-8-10-23(11-9-21)33-22-6-4-3-5-7-22/h3-11,14,17,19H,2,12-13,15-16H2,1H3 |
| InChIKey | DNKDWOYSRSXSLV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |