C15H13N3O5S — CID 4275148
2-[6-(2-ethoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetic acid (PubChem CID 4275148) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-[6-(2-ethoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetic acid.
| Compound Name | 2-[6-(2-ethoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 4275148 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-[6-(2-ethoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetic acid |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1-c1cn2cc(CC(=O)O)sc2n1 |
| InChI | InChI=1S/C15H13N3O5S/c1-2-23-13-4-3-9(18(21)22)5-11(13)12-8-17-7-10(6-14(19)20)24-15(17)16-12/h3-5,7-8H,2,6H2,1H3,(H,19,20) |
| InChIKey | CNCSESIYVVXJCG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|