C17H15N3O6S — CID 4010343
ethyl 2-[5-formyl-6-(2-methoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 4010343) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is ethyl 2-[5-formyl-6-(2-methoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[5-formyl-6-(2-methoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 4010343 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | ethyl 2-[5-formyl-6-(2-methoxy-5-nitrophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3cc([N+](=O)[O-])ccc3OC)nc2s1 |
| InChI | InChI=1S/C17H15N3O6S/c1-3-26-15(22)7-11-8-19-13(9-21)16(18-17(19)27-11)12-6-10(20(23)24)4-5-14(12)25-2/h4-6,8-9H,3,7H2,1-2H3 |
| InChIKey | HQNXVLMZANGKAC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|