C13H16N2O3S — CID 5030828
ethyl 2-(5-formyl-6-propan-2-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetate (PubChem CID 5030828) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl 2-(5-formyl-6-propan-2-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetate.
| Compound Name | ethyl 2-(5-formyl-6-propan-2-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 5030828 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 2-(5-formyl-6-propan-2-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(C(C)C)nc2s1 |
| InChI | InChI=1S/C13H16N2O3S/c1-4-18-11(17)5-9-6-15-10(7-16)12(8(2)3)14-13(15)19-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | WBRBBVUSUPEBLG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|