C24H22N2O5S — CID 3993192
ethyl 2-[5-formyl-6-(3-methoxy-4-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 3993192) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is ethyl 2-[5-formyl-6-(3-methoxy-4-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[5-formyl-6-(3-methoxy-4-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 3993192 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 2-[5-formyl-6-(3-methoxy-4-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3ccc(OCc4ccccc4)c(OC)c3)nc2s1 |
| InChI | InChI=1S/C24H22N2O5S/c1-3-30-22(28)12-18-13-26-19(14-27)23(25-24(26)32-18)17-9-10-20(21(11-17)29-2)31-15-16-7-5-4-6-8-16/h4-11,13-14H,3,12,15H2,1-2H3 |
| InChIKey | KIPRKRUZYYMIDE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|