C26H34N2O4S — CID 4265363
ethyl 2-[6-(3,5-ditert-butyl-4-ethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 4265363) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is ethyl 2-[6-(3,5-ditert-butyl-4-ethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-(3,5-ditert-butyl-4-ethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 4265363 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | ethyl 2-[6-(3,5-ditert-butyl-4-ethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3cc(C(C)(C)C)c(OCC)c(C(C)(C)C)c3)nc2s1 |
| InChI | InChI=1S/C26H34N2O4S/c1-9-31-21(30)13-17-14-28-20(15-29)22(27-24(28)33-17)16-11-18(25(3,4)5)23(32-10-2)19(12-16)26(6,7)8/h11-12,14-15H,9-10,13H2,1-8H3 |
| InChIKey | DBIASJRFVDVNST-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|