C24H30N2O5S — CID 4009636
ethyl 2-[6-(5-tert-butyl-2,3-diethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 4009636) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is ethyl 2-[6-(5-tert-butyl-2,3-diethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-(5-tert-butyl-2,3-diethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 4009636 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | ethyl 2-[6-(5-tert-butyl-2,3-diethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3cc(C(C)(C)C)cc(OCC)c3OCC)nc2s1 |
| InChI | InChI=1S/C24H30N2O5S/c1-7-29-19-11-15(24(4,5)6)10-17(22(19)31-9-3)21-18(14-27)26-13-16(32-23(26)25-21)12-20(28)30-8-2/h10-11,13-14H,7-9,12H2,1-6H3 |
| InChIKey | XJQIBASLDRTYOC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|