C21H18N2O4S — CID 3414869
ethyl 2-[5-formyl-6-(2-methoxynaphthalen-1-yl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 3414869) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl 2-[5-formyl-6-(2-methoxynaphthalen-1-yl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[5-formyl-6-(2-methoxynaphthalen-1-yl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 3414869 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 2-[5-formyl-6-(2-methoxynaphthalen-1-yl)imidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3c(OC)ccc4ccccc34)nc2s1 |
| InChI | InChI=1S/C21H18N2O4S/c1-3-27-18(25)10-14-11-23-16(12-24)20(22-21(23)28-14)19-15-7-5-4-6-13(15)8-9-17(19)26-2/h4-9,11-12H,3,10H2,1-2H3 |
| InChIKey | CWCOEOTWYBEHJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|