C23H19FN2O4S — CID 3966382
ethyl 2-[6-(5-fluoro-2-phenylmethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 3966382) has the molecular formula C23H19FN2O4S and a molecular weight of 438.48 g/mol. Its IUPAC name is ethyl 2-[6-(5-fluoro-2-phenylmethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-(5-fluoro-2-phenylmethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 3966382 |
| Molecular Formula | C23H19FN2O4S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 2-[6-(5-fluoro-2-phenylmethoxyphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3cc(F)ccc3OCc3ccccc3)nc2s1 |
| InChI | InChI=1S/C23H19FN2O4S/c1-2-29-21(28)11-17-12-26-19(13-27)22(25-23(26)31-17)18-10-16(24)8-9-20(18)30-14-15-6-4-3-5-7-15/h3-10,12-13H,2,11,14H2,1H3 |
| InChIKey | UWNLIWOKGFVNNO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|