C25H32N2O4S — CID 4016869
ethyl 2-[6-[3,5-di(butan-2-yl)-4-methoxyphenyl]-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 4016869) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is ethyl 2-[6-[3,5-di(butan-2-yl)-4-methoxyphenyl]-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-[3,5-di(butan-2-yl)-4-methoxyphenyl]-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 4016869 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | ethyl 2-[6-[3,5-di(butan-2-yl)-4-methoxyphenyl]-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3cc(C(C)CC)c(OC)c(C(C)CC)c3)nc2s1 |
| InChI | InChI=1S/C25H32N2O4S/c1-7-15(4)19-10-17(11-20(16(5)8-2)24(19)30-6)23-21(14-28)27-13-18(32-25(27)26-23)12-22(29)31-9-3/h10-11,13-16H,7-9,12H2,1-6H3 |
| InChIKey | GZYILWFIIFOUCE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|