C20H22N2O3S — CID 3633850
ethyl 2-[6-(4-tert-butylphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate (PubChem CID 3633850) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is ethyl 2-[6-(4-tert-butylphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-(4-tert-butylphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 3633850 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 2-[6-(4-tert-butylphenyl)-5-formylimidazo[2,1-b][1,3]thiazol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2c(C=O)c(-c3ccc(C(C)(C)C)cc3)nc2s1 |
| InChI | InChI=1S/C20H22N2O3S/c1-5-25-17(24)10-15-11-22-16(12-23)18(21-19(22)26-15)13-6-8-14(9-7-13)20(2,3)4/h6-9,11-12H,5,10H2,1-4H3 |
| InChIKey | UTIRDRQVHSHRFH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|