C23H32N4O2S — CID 42768503
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[[2,6-di(propan-2-yl)phenyl]carbamoyl-prop-2-enylamino]acetamide (PubChem CID 42768503) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[[2,6-di(propan-2-yl)phenyl]carbamoyl-prop-2-enylamino]acetamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[[2,6-di(propan-2-yl)phenyl]carbamoyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 42768503 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-[[2,6-di(propan-2-yl)phenyl]carbamoyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1nc(C)c(C)s1)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H32N4O2S/c1-8-12-27(13-20(28)25-22-24-16(6)17(7)30-22)23(29)26-21-18(14(2)3)10-9-11-19(21)15(4)5/h8-11,14-15H,1,12-13H2,2-7H3,(H,26,29)(H,24,25,28) |
| InChIKey | IVYYYJSGVSTICF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|