C13H17N3O4S — CID 84573294
methyl 2-[[2-[acetyl(prop-2-enyl)amino]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 84573294) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 2-[[2-[acetyl(prop-2-enyl)amino]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[2-[acetyl(prop-2-enyl)amino]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 84573294 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 2-[[2-[acetyl(prop-2-enyl)amino]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCN(CC(=O)Nc1nc(C)c(C(=O)OC)s1)C(C)=O |
| InChI | InChI=1S/C13H17N3O4S/c1-5-6-16(9(3)17)7-10(18)15-13-14-8(2)11(21-13)12(19)20-4/h5H,1,6-7H2,2-4H3,(H,14,15,18) |
| InChIKey | AUFPDYMIIXSGCZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|