C25H25ClFN3O5 — CID 42773478
4-chloro-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide (PubChem CID 42773478) has the molecular formula C25H25ClFN3O5 and a molecular weight of 501.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 42773478 |
| Molecular Formula | C25H25ClFN3O5 |
| Molecular Weight | 501.94 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-chloro-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide |
| SMILES | CC(C)CN(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25ClFN3O5/c1-17(2)13-29(25(32)19-7-10-22(26)23(12-19)30(33)34)16-24(31)28(15-21-4-3-11-35-21)14-18-5-8-20(27)9-6-18/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | RCCHARXYBIBJHN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|