C31H29N3O2 — CID 42774633
3-(1-methylindol-3-yl)-3-(3-phenylmethoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 42774633) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-3-(3-phenylmethoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-(1-methylindol-3-yl)-3-(3-phenylmethoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42774633 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-(1-methylindol-3-yl)-3-(3-phenylmethoxyphenyl)-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | Cn1cc(C(CC(=O)NCc2ccncc2)c2cccc(OCc3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C31H29N3O2/c1-34-21-29(27-12-5-6-13-30(27)34)28(19-31(35)33-20-23-14-16-32-17-15-23)25-10-7-11-26(18-25)36-22-24-8-3-2-4-9-24/h2-18,21,28H,19-20,22H2,1H3,(H,33,35) |
| InChIKey | ZLJKOOMMGRIUBL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |