C22H21N3OS — CID 42774657
3-(1-methylindol-3-yl)-N-(pyridin-4-ylmethyl)-3-thiophen-3-ylpropanamide (PubChem CID 42774657) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-N-(pyridin-4-ylmethyl)-3-thiophen-3-ylpropanamide.
| Compound Name | 3-(1-methylindol-3-yl)-N-(pyridin-4-ylmethyl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 42774657 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-(1-methylindol-3-yl)-N-(pyridin-4-ylmethyl)-3-thiophen-3-ylpropanamide |
| SMILES | Cn1cc(C(CC(=O)NCc2ccncc2)c2ccsc2)c2ccccc21 |
| InChI | InChI=1S/C22H21N3OS/c1-25-14-20(18-4-2-3-5-21(18)25)19(17-8-11-27-15-17)12-22(26)24-13-16-6-9-23-10-7-16/h2-11,14-15,19H,12-13H2,1H3,(H,24,26) |
| InChIKey | ZECGGKHTNICZMB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |