C21H21NO5S2 — CID 4277959
N-[3-(benzenesulfonyl)-4-hydroxy-2,6-dimethylphenyl]-4-methylbenzenesulfonamide (PubChem CID 4277959) has the molecular formula C21H21NO5S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-4-hydroxy-2,6-dimethylphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)-4-hydroxy-2,6-dimethylphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4277959 |
| Molecular Formula | C21H21NO5S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-[3-(benzenesulfonyl)-4-hydroxy-2,6-dimethylphenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(C)cc(O)c(S(=O)(=O)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C21H21NO5S2/c1-14-9-11-18(12-10-14)29(26,27)22-20-15(2)13-19(23)21(16(20)3)28(24,25)17-7-5-4-6-8-17/h4-13,22-23H,1-3H3 |
| InChIKey | KPLQPINNVDPTME-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|