C18H31N3O3 — CID 42780049
N-[3-[5-(diethylamino)pentan-2-ylamino]-3-oxopropyl]-2-methylfuran-3-carboxamide (PubChem CID 42780049) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[3-[5-(diethylamino)pentan-2-ylamino]-3-oxopropyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[3-[5-(diethylamino)pentan-2-ylamino]-3-oxopropyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 42780049 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-[3-[5-(diethylamino)pentan-2-ylamino]-3-oxopropyl]-2-methylfuran-3-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CCNC(=O)c1ccoc1C |
| InChI | InChI=1S/C18H31N3O3/c1-5-21(6-2)12-7-8-14(3)20-17(22)9-11-19-18(23)16-10-13-24-15(16)4/h10,13-14H,5-9,11-12H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | BVOHPULZQHMFFI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |