C16H11N4O4S- — CID 4278118
4-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 4278118) has the molecular formula C16H11N4O4S- and a molecular weight of 355.36 g/mol. Its IUPAC name is 4-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | 4-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 4278118 |
| Molecular Formula | C16H11N4O4S- |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1c(Sc2ccc(C(=O)[O-])cc2[N+](=O)[O-])nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H12N4O4S/c1-19-14(10-5-3-2-4-6-10)17-18-16(19)25-13-8-7-11(15(21)22)9-12(13)20(23)24/h2-9H,1H3,(H,21,22)/p-1 |
| InChIKey | AISKWKVMKYLMGA-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 113.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|