C28H27N5O5 — CID 42783800
3-(1,3-benzodioxol-5-yl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one (PubChem CID 42783800) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42783800 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1cccn2c(C(CC(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c3ccc4c(c3)OCO4)cnc12 |
| InChI | InChI=1S/C28H27N5O5/c1-19-3-2-10-32-24(17-29-28(19)32)23(20-4-9-25-26(15-20)38-18-37-25)16-27(34)31-13-11-30(12-14-31)21-5-7-22(8-6-21)33(35)36/h2-10,15,17,23H,11-14,16,18H2,1H3 |
| InChIKey | YKLJPAOWKSAEHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|