C27H32FN3O5 — CID 42783967
2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]acetamide (PubChem CID 42783967) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]acetamide.
| Compound Name | 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 42783967 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]acetamide |
| SMILES | CCCCNC(=O)N(CCOC)CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O |
| InChI | InChI=1S/C27H32FN3O5/c1-3-4-13-29-27(34)30(14-15-35-2)18-25(32)31(16-20-9-11-22(28)12-10-20)17-21-19-36-24-8-6-5-7-23(24)26(21)33/h5-12,19H,3-4,13-18H2,1-2H3,(H,29,34) |
| InChIKey | WNJQXHDJLQJWMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|