C35H37FN2O6 — CID 42785973
4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42785973) has the molecular formula C35H37FN2O6 and a molecular weight of 600.69 g/mol. Its IUPAC name is 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42785973 |
| Molecular Formula | C35H37FN2O6 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CC(=O)N(Cc2ccc(F)cc2)Cc2coc3ccccc3c2=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C35H37FN2O6/c1-2-3-18-42-29-16-12-26(13-17-29)35(41)38(22-30-7-6-19-43-30)23-33(39)37(20-25-10-14-28(36)15-11-25)21-27-24-44-32-9-5-4-8-31(32)34(27)40/h4-5,8-17,24,30H,2-3,6-7,18-23H2,1H3 |
| InChIKey | MAUCIEFKBHBSEY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|