C30H37N3O5 — CID 4290074
N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide (PubChem CID 4290074) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4290074 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(6-methyl-4-oxochromen-3-yl)methyl]acetamide |
| SMILES | CCCCNC(=O)N(CC(=O)N(Cc1ccccc1)Cc1coc2ccc(C)cc2c1=O)CC1CCCO1 |
| InChI | InChI=1S/C30H37N3O5/c1-3-4-14-31-30(36)33(19-25-11-8-15-37-25)20-28(34)32(17-23-9-6-5-7-10-23)18-24-21-38-27-13-12-22(2)16-26(27)29(24)35/h5-7,9-10,12-13,16,21,25H,3-4,8,11,14-15,17-20H2,1-2H3,(H,31,36) |
| InChIKey | XLAANVOENMRYNP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|