C19H19F3N2O3 — CID 42791246
N-(2-methoxyethyl)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 42791246) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 42791246 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc2oc(C)cc2n1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-12-9-15-17(27-12)10-16(18(25)23-7-8-26-2)24(15)11-13-3-5-14(6-4-13)19(20,21)22/h3-6,9-10H,7-8,11H2,1-2H3,(H,23,25) |
| InChIKey | ZIMHTDMWYGDIDH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|