C28H30ClFN4O2 — CID 20885172
4-[(4-chlorophenyl)methyl]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 20885172) has the molecular formula C28H30ClFN4O2 and a molecular weight of 509.03 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 20885172 |
| Molecular Formula | C28H30ClFN4O2 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1cc2c(cc(C(=O)NCCCN3CCN(c4ccccc4F)CC3)n2Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C28H30ClFN4O2/c1-20-17-25-27(36-20)18-26(34(25)19-21-7-9-22(29)10-8-21)28(35)31-11-4-12-32-13-15-33(16-14-32)24-6-3-2-5-23(24)30/h2-3,5-10,17-18H,4,11-16,19H2,1H3,(H,31,35) |
| InChIKey | MRSOLBVZBUIUIG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|