C22H25F2N3O3 — CID 42791595
4-[(2,4-difluorophenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 42791595) has the molecular formula C22H25F2N3O3 and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 42791595 |
| Molecular Formula | C22H25F2N3O3 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1cc2c(cc(C(=O)NCCCN3CCOCC3)n2Cc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C22H25F2N3O3/c1-15-11-19-21(30-15)13-20(27(19)14-16-3-4-17(23)12-18(16)24)22(28)25-5-2-6-26-7-9-29-10-8-26/h3-4,11-13H,2,5-10,14H2,1H3,(H,25,28) |
| InChIKey | SLVNTTLNGOKTEP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|