C17H24BrN3O4 — CID 91958895
2-bromo-4-(2-methoxyethyl)-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 91958895) has the molecular formula C17H24BrN3O4 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-bromo-4-(2-methoxyethyl)-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-(2-methoxyethyl)-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91958895 |
| Molecular Formula | C17H24BrN3O4 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-bromo-4-(2-methoxyethyl)-N-(3-morpholin-4-ylpropyl)furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | COCCn1c(C(=O)NCCCN2CCOCC2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C17H24BrN3O4/c1-23-8-7-21-13-12-16(18)25-15(13)11-14(21)17(22)19-3-2-4-20-5-9-24-10-6-20/h11-12H,2-10H2,1H3,(H,19,22) |
| InChIKey | JYFQFAGJHHTSST-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|