C20H23N3O4 — CID 7495335
2-methyl-N-(3-methylbutyl)-4-[(3-nitrophenyl)methyl]furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 7495335) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-methyl-N-(3-methylbutyl)-4-[(3-nitrophenyl)methyl]furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-methyl-N-(3-methylbutyl)-4-[(3-nitrophenyl)methyl]furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 7495335 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-methyl-N-(3-methylbutyl)-4-[(3-nitrophenyl)methyl]furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1cc2c(cc(C(=O)NCCC(C)C)n2Cc2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(2)7-8-21-20(24)18-11-19-17(9-14(3)27-19)22(18)12-15-5-4-6-16(10-15)23(25)26/h4-6,9-11,13H,7-8,12H2,1-3H3,(H,21,24) |
| InChIKey | VDVLFVPRCUHBNM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|