C16H18N2O4S — CID 141483910
2,5-dimethyl-N-[2-[(3-nitrophenyl)methylsulfanyl]ethyl]furan-3-carboxamide (PubChem CID 141483910) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[(3-nitrophenyl)methylsulfanyl]ethyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-[(3-nitrophenyl)methylsulfanyl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 141483910 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2,5-dimethyl-N-[2-[(3-nitrophenyl)methylsulfanyl]ethyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCSCc2cccc([N+](=O)[O-])c2)c(C)o1 |
| InChI | InChI=1S/C16H18N2O4S/c1-11-8-15(12(2)22-11)16(19)17-6-7-23-10-13-4-3-5-14(9-13)18(20)21/h3-5,8-9H,6-7,10H2,1-2H3,(H,17,19) |
| InChIKey | MAZUVVVPGMCVSC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|