C15H18N4O2S — CID 42794486
N,N-dimethyl-3-oxo-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxamide (PubChem CID 42794486) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxamide.
| Compound Name | N,N-dimethyl-3-oxo-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxamide |
|---|---|
| PubChem CID | 42794486 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N,N-dimethyl-3-oxo-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxamide |
| SMILES | C=CCn1cnc2sc3c(c2c1=O)CCN(C(=O)N(C)C)C3 |
| InChI | InChI=1S/C15H18N4O2S/c1-4-6-19-9-16-13-12(14(19)20)10-5-7-18(8-11(10)22-13)15(21)17(2)3/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | IHYLVNUQVHLVNF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|