C21H19N3O2S — CID 7225723
11-[(E)-3-phenylprop-2-enoyl]-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 7225723) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 11-[(E)-3-phenylprop-2-enoyl]-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-[(E)-3-phenylprop-2-enoyl]-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 7225723 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 11-[(E)-3-phenylprop-2-enoyl]-4-prop-2-enyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C=CCn1cnc2sc3c(c2c1=O)CCN(C(=O)/C=C/c1ccccc1)C3 |
| InChI | InChI=1S/C21H19N3O2S/c1-2-11-24-14-22-20-19(21(24)26)16-10-12-23(13-17(16)27-20)18(25)9-8-15-6-4-3-5-7-15/h2-9,14H,1,10-13H2/b9-8+ |
| InChIKey | DPNLIMGBDDBUCG-CMDGGOBGSA-N |
| XLogP | 3.24 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|