C27H26ClN3O2S — CID 42794495
11-(3-chloro-2,2-dimethylpropanoyl)-4-[(4-phenylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 42794495) has the molecular formula C27H26ClN3O2S and a molecular weight of 492.04 g/mol. Its IUPAC name is 11-(3-chloro-2,2-dimethylpropanoyl)-4-[(4-phenylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-(3-chloro-2,2-dimethylpropanoyl)-4-[(4-phenylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 42794495 |
| Molecular Formula | C27H26ClN3O2S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 11-(3-chloro-2,2-dimethylpropanoyl)-4-[(4-phenylphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CC(C)(CCl)C(=O)N1CCc2c(sc3ncn(Cc4ccc(-c5ccccc5)cc4)c(=O)c23)C1 |
| InChI | InChI=1S/C27H26ClN3O2S/c1-27(2,16-28)26(33)30-13-12-21-22(15-30)34-24-23(21)25(32)31(17-29-24)14-18-8-10-20(11-9-18)19-6-4-3-5-7-19/h3-11,17H,12-16H2,1-2H3 |
| InChIKey | UGCOOYDONVMPTC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|