C16H19N3O2S — CID 42795513
4-[[5-(hydroxymethyl)-1-(3-methoxypropyl)imidazol-2-yl]sulfanylmethyl]benzonitrile (PubChem CID 42795513) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[[5-(hydroxymethyl)-1-(3-methoxypropyl)imidazol-2-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 4-[[5-(hydroxymethyl)-1-(3-methoxypropyl)imidazol-2-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 42795513 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-[[5-(hydroxymethyl)-1-(3-methoxypropyl)imidazol-2-yl]sulfanylmethyl]benzonitrile |
| SMILES | COCCCn1c(CO)cnc1SCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-21-8-2-7-19-15(11-20)10-18-16(19)22-12-14-5-3-13(9-17)4-6-14/h3-6,10,20H,2,7-8,11-12H2,1H3 |
| InChIKey | REXUFYYXJYPJIM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|