C16H20N2O4S — CID 42795506
benzyl 2-[5-(hydroxymethyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanylacetate (PubChem CID 42795506) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is benzyl 2-[5-(hydroxymethyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanylacetate.
| Compound Name | benzyl 2-[5-(hydroxymethyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 42795506 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | benzyl 2-[5-(hydroxymethyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanylacetate |
| SMILES | COCCn1c(CO)cnc1SCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-21-8-7-18-14(10-19)9-17-16(18)23-12-15(20)22-11-13-5-3-2-4-6-13/h2-6,9,19H,7-8,10-12H2,1H3 |
| InChIKey | PCHLEGSJWAZJPF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |