C25H31N3O3S — CID 3169028
benzyl 2-[[5-(4-tert-butylphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 3169028) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is benzyl 2-[[5-(4-tert-butylphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | benzyl 2-[[5-(4-tert-butylphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 3169028 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | benzyl 2-[[5-(4-tert-butylphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | COCCCn1c(SCC(=O)OCc2ccccc2)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-25(2,3)21-13-11-20(12-14-21)23-26-27-24(28(23)15-8-16-30-4)32-18-22(29)31-17-19-9-6-5-7-10-19/h5-7,9-14H,8,15-18H2,1-4H3 |
| InChIKey | CUWGMCKPQJSMFZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|