C23H22N2OS — CID 42797250
N,6-bis(1-phenylethyl)thieno[2,3-b]pyrrole-5-carboxamide (PubChem CID 42797250) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N,6-bis(1-phenylethyl)thieno[2,3-b]pyrrole-5-carboxamide.
| Compound Name | N,6-bis(1-phenylethyl)thieno[2,3-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 42797250 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N,6-bis(1-phenylethyl)thieno[2,3-b]pyrrole-5-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccsc2n1C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2OS/c1-16(18-9-5-3-6-10-18)24-22(26)21-15-20-13-14-27-23(20)25(21)17(2)19-11-7-4-8-12-19/h3-17H,1-2H3,(H,24,26) |
| InChIKey | IQKOROKARFAEPD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |