C24H32N4O2S — CID 42803276
1-[4-[[6-(3-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]methyl]piperazin-1-yl]hexan-1-one (PubChem CID 42803276) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[4-[[6-(3-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]methyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[[6-(3-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]methyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 42803276 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-[4-[[6-(3-methoxyphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]methyl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(Cc2c(-c3cccc(OC)c3)nc3scc(C)n23)CC1 |
| InChI | InChI=1S/C24H32N4O2S/c1-4-5-6-10-22(29)27-13-11-26(12-14-27)16-21-23(19-8-7-9-20(15-19)30-3)25-24-28(21)18(2)17-31-24/h7-9,15,17H,4-6,10-14,16H2,1-3H3 |
| InChIKey | QLSWMZWXIPFTOV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|