C22H19ClN4O2 — CID 42804957
3-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-methyl-9-prop-2-enoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 42804957) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-methyl-9-prop-2-enoxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-methyl-9-prop-2-enoxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 42804957 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-[1-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-methyl-9-prop-2-enoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=CCOc1cccn2c(=O)c(-c3cc(C)n(-c4cccc(Cl)c4)n3)c(C)nc12 |
| InChI | InChI=1S/C22H19ClN4O2/c1-4-11-29-19-9-6-10-26-21(19)24-15(3)20(22(26)28)18-12-14(2)27(25-18)17-8-5-7-16(23)13-17/h4-10,12-13H,1,11H2,2-3H3 |
| InChIKey | XHTCNDQMFUDWOU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|