C27H23N5O5 — CID 42804935
3-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]-2-methyl-9-[(4-nitrophenyl)methoxy]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 42804935) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is 3-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]-2-methyl-9-[(4-nitrophenyl)methoxy]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]-2-methyl-9-[(4-nitrophenyl)methoxy]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 42804935 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 3-[1-(3-methoxyphenyl)-5-methylpyrazol-3-yl]-2-methyl-9-[(4-nitrophenyl)methoxy]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1cccc(-n2nc(-c3c(C)nc4c(OCc5ccc([N+](=O)[O-])cc5)cccn4c3=O)cc2C)c1 |
| InChI | InChI=1S/C27H23N5O5/c1-17-14-23(29-31(17)21-6-4-7-22(15-21)36-3)25-18(2)28-26-24(8-5-13-30(26)27(25)33)37-16-19-9-11-20(12-10-19)32(34)35/h4-15H,16H2,1-3H3 |
| InChIKey | UQYLLQMGUQMTEB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|