C16H18ClFN4O3S — CID 42807406
4-(4-chloro-2-fluorophenoxy)-6-(4-ethylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 42807406) has the molecular formula C16H18ClFN4O3S and a molecular weight of 400.86 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenoxy)-6-(4-ethylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(4-chloro-2-fluorophenoxy)-6-(4-ethylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 42807406 |
| Molecular Formula | C16H18ClFN4O3S |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-(4-chloro-2-fluorophenoxy)-6-(4-ethylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | CCS(=O)(=O)N1CCN(c2cc(Oc3ccc(Cl)cc3F)ncn2)CC1 |
| InChI | InChI=1S/C16H18ClFN4O3S/c1-2-26(23,24)22-7-5-21(6-8-22)15-10-16(20-11-19-15)25-14-4-3-12(17)9-13(14)18/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | PGBIRDRTRGDEEZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |