C20H24ClFN4O2 — CID 83281711
1-[4-[6-(4-chloro-2-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]hexan-1-one (PubChem CID 83281711) has the molecular formula C20H24ClFN4O2 and a molecular weight of 406.89 g/mol. Its IUPAC name is 1-[4-[6-(4-chloro-2-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[6-(4-chloro-2-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 83281711 |
| Molecular Formula | C20H24ClFN4O2 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[4-[6-(4-chloro-2-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(c2cc(Oc3ccc(Cl)cc3F)ncn2)CC1 |
| InChI | InChI=1S/C20H24ClFN4O2/c1-2-3-4-5-20(27)26-10-8-25(9-11-26)18-13-19(24-14-23-18)28-17-7-6-15(21)12-16(17)22/h6-7,12-14H,2-5,8-11H2,1H3 |
| InChIKey | OTSFZUZFWRNTGV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|