C18H21FN4O3 — CID 91634842
ethyl 4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 91634842) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is ethyl 4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91634842 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | ethyl 4-[6-(4-fluoro-2-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(Oc3ccc(F)cc3C)ncn2)CC1 |
| InChI | InChI=1S/C18H21FN4O3/c1-3-25-18(24)23-8-6-22(7-9-23)16-11-17(21-12-20-16)26-15-5-4-14(19)10-13(15)2/h4-5,10-12H,3,6-9H2,1-2H3 |
| InChIKey | JGJVYUJXPOMPQZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |