C24H30N4O — CID 42808876
[5-amino-1-[(2,5-dimethylphenyl)methyl]indol-2-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 42808876) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is [5-amino-1-[(2,5-dimethylphenyl)methyl]indol-2-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [5-amino-1-[(2,5-dimethylphenyl)methyl]indol-2-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42808876 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [5-amino-1-[(2,5-dimethylphenyl)methyl]indol-2-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc3cc(N)ccc3n2Cc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-4-26-9-11-27(12-10-26)24(29)23-15-19-14-21(25)7-8-22(19)28(23)16-20-13-17(2)5-6-18(20)3/h5-8,13-15H,4,9-12,16,25H2,1-3H3 |
| InChIKey | BNNUVWDQZWPXJF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|