C17H21N3O3 — CID 42810860
N-cyclopropyl-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)butanamide (PubChem CID 42810860) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-cyclopropyl-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)butanamide.
| Compound Name | N-cyclopropyl-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)butanamide |
|---|---|
| PubChem CID | 42810860 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclopropyl-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)butanamide |
| SMILES | CCC(C(=O)NC1CC1)n1c(=O)n(CC)c(=O)c2ccccc21 |
| InChI | InChI=1S/C17H21N3O3/c1-3-13(15(21)18-11-9-10-11)20-14-8-6-5-7-12(14)16(22)19(4-2)17(20)23/h5-8,11,13H,3-4,9-10H2,1-2H3,(H,18,21) |
| InChIKey | FASHYJBRPSZHLJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |