C20H18ClN3O3 — CID 42811778
2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-cyclopropylpropanamide (PubChem CID 42811778) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-cyclopropylpropanamide.
| Compound Name | 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 42811778 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-cyclopropylpropanamide |
| SMILES | CC(C(=O)NC1CC1)n1c(=O)n(-c2ccccc2Cl)c(=O)c2ccccc21 |
| InChI | InChI=1S/C20H18ClN3O3/c1-12(18(25)22-13-10-11-13)23-16-8-4-2-6-14(16)19(26)24(20(23)27)17-9-5-3-7-15(17)21/h2-9,12-13H,10-11H2,1H3,(H,22,25) |
| InChIKey | SSLKCUKYQDEQDH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |