C15H19ClN2O3S — CID 42814932
2-[2-(2-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 42814932) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[2-(2-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 42814932 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)N1C(=O)CSC1c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN2O3S/c1-10(14(20)17-7-8-21-2)18-13(19)9-22-15(18)11-5-3-4-6-12(11)16/h3-6,10,15H,7-9H2,1-2H3,(H,17,20) |
| InChIKey | AGGOJJJZUXHLLN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|